About 1-iodo-2-propylimidazole
1-iodo-2-propylimidazole (PubChem CID 139936657) has the molecular formula C6H9IN2
and a molecular weight of 236.06 g/mol. Its IUPAC name is 1-iodo-2-propylimidazole.
Molecular Properties
| Compound Name | 1-iodo-2-propylimidazole |
| PubChem CID | 139936657 |
| Molecular Formula | C6H9IN2 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 1-iodo-2-propylimidazole |
| SMILES | CCCc1nccn1I |
| InChI | InChI=1S/C6H9IN2/c1-2-3-6-8-4-5-9(6)7/h4-5H,2-3H2,1H3 |
| InChIKey | SJDBPTFIJSCONL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-2-propylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-2-propylimidazole?
The IUPAC name of 1-iodo-2-propylimidazole (CID 139936657) is 1-iodo-2-propylimidazole.
What is the SMILES notation for 1-iodo-2-propylimidazole?
The canonical SMILES for 1-iodo-2-propylimidazole is CCCc1nccn1I.
What is the InChIKey of 1-iodo-2-propylimidazole?
The InChIKey is SJDBPTFIJSCONL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9IN2/c1-2-3-6-8-4-5-9(6)7/h4-5H,2-3H2,1H3.
What are the key properties of 1-iodo-2-propylimidazole?
1-iodo-2-propylimidazole has a molecular weight of 236.06 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-2-propylimidazole is sourced from PubChem (CID 139936657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).