C15H22N2O4 — CID 139936824
3-[1,1-dihydroxy-3-(4-methylphenyl)-2-oxopropyl]-1,1-diethylurea (PubChem CID 139936824) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-[1,1-dihydroxy-3-(4-methylphenyl)-2-oxopropyl]-1,1-diethylurea.
| Compound Name | 3-[1,1-dihydroxy-3-(4-methylphenyl)-2-oxopropyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 139936824 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-[1,1-dihydroxy-3-(4-methylphenyl)-2-oxopropyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NC(O)(O)C(=O)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C15H22N2O4/c1-4-17(5-2)14(19)16-15(20,21)13(18)10-12-8-6-11(3)7-9-12/h6-9,20-21H,4-5,10H2,1-3H3,(H,16,19) |
| InChIKey | ORRJVEJHIYOMTD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|