C20H24F3NO — CID 139938816
1,4-diethyl-2-[2-(trifluoromethyl)phenyl]-2,4,5,6,7,8-hexahydroquinolin-3-one (PubChem CID 139938816) has the molecular formula C20H24F3NO and a molecular weight of 351.41 g/mol. Its IUPAC name is 1,4-diethyl-2-[2-(trifluoromethyl)phenyl]-2,4,5,6,7,8-hexahydroquinolin-3-one.
| Compound Name | 1,4-diethyl-2-[2-(trifluoromethyl)phenyl]-2,4,5,6,7,8-hexahydroquinolin-3-one |
|---|---|
| PubChem CID | 139938816 |
| Molecular Formula | C20H24F3NO |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1,4-diethyl-2-[2-(trifluoromethyl)phenyl]-2,4,5,6,7,8-hexahydroquinolin-3-one |
| SMILES | CCC1C(=O)C(c2ccccc2C(F)(F)F)N(CC)C2=C1CCCC2 |
| InChI | InChI=1S/C20H24F3NO/c1-3-13-14-9-6-8-12-17(14)24(4-2)18(19(13)25)15-10-5-7-11-16(15)20(21,22)23/h5,7,10-11,13,18H,3-4,6,8-9,12H2,1-2H3 |
| InChIKey | WXOXHNKPIBJNTD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |