C21H23F3N2 — CID 143417048
(Z)-[1-ethyl-6-[2-[2-(trifluoromethyl)phenyl]phenyl]piperidin-2-ylidene]methanamine (PubChem CID 143417048) has the molecular formula C21H23F3N2 and a molecular weight of 360.42 g/mol. Its IUPAC name is (Z)-[1-ethyl-6-[2-[2-(trifluoromethyl)phenyl]phenyl]piperidin-2-ylidene]methanamine.
| Compound Name | (Z)-[1-ethyl-6-[2-[2-(trifluoromethyl)phenyl]phenyl]piperidin-2-ylidene]methanamine |
|---|---|
| PubChem CID | 143417048 |
| Molecular Formula | C21H23F3N2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (Z)-[1-ethyl-6-[2-[2-(trifluoromethyl)phenyl]phenyl]piperidin-2-ylidene]methanamine |
| SMILES | CCN1/C(=C\N)CCCC1c1ccccc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H23F3N2/c1-2-26-15(14-25)8-7-13-20(26)18-11-4-3-9-16(18)17-10-5-6-12-19(17)21(22,23)24/h3-6,9-12,14,20H,2,7-8,13,25H2,1H3/b15-14- |
| InChIKey | YOQFSFJAXSUUJO-PFONDFGASA-N |
| XLogP | 5.72 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |