C23H30N2O3S2 — CID 139939335
4-[(5Z)-4-oxo-5-[[4-(3-pentylpyrrolidin-1-yl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 139939335) has the molecular formula C23H30N2O3S2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 4-[(5Z)-4-oxo-5-[[4-(3-pentylpyrrolidin-1-yl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[(5Z)-4-oxo-5-[[4-(3-pentylpyrrolidin-1-yl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 139939335 |
| Molecular Formula | C23H30N2O3S2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 4-[(5Z)-4-oxo-5-[[4-(3-pentylpyrrolidin-1-yl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | CCCCCC1CCN(c2ccc(/C=C3\SC(=S)N(CCCC(=O)O)C3=O)cc2)C1 |
| InChI | InChI=1S/C23H30N2O3S2/c1-2-3-4-6-18-12-14-24(16-18)19-10-8-17(9-11-19)15-20-22(28)25(23(29)30-20)13-5-7-21(26)27/h8-11,15,18H,2-7,12-14,16H2,1H3,(H,26,27)/b20-15- |
| InChIKey | GLLPNMKPFMRCCU-HKWRFOASSA-N |
| XLogP | 5.16 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|