C12H17NO3S3 — CID 139940512
4-methylbenzenesulfonate;3-methyl-2-methylsulfanyl-4,5-dihydro-1,3-thiazol-3-ium (PubChem CID 139940512) has the molecular formula C12H17NO3S3 and a molecular weight of 319.47 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;3-methyl-2-methylsulfanyl-4,5-dihydro-1,3-thiazol-3-ium.
| Compound Name | 4-methylbenzenesulfonate;3-methyl-2-methylsulfanyl-4,5-dihydro-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 139940512 |
| Molecular Formula | C12H17NO3S3 |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 4-methylbenzenesulfonate;3-methyl-2-methylsulfanyl-4,5-dihydro-1,3-thiazol-3-ium |
| SMILES | CSC1=[N+](C)CCS1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C5H10NS2/c1-6-2-4-7(5-3-6)11(8,9)10;1-6-3-4-8-5(6)7-2/h2-5H,1H3,(H,8,9,10);3-4H2,1-2H3/q;+1/p-1 |
| InChIKey | BTKIYXOZUZNTPP-UHFFFAOYSA-M |
| XLogP | 1.99 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|