C39H37N3O4S — CID 139943832
N-[4-[4-[[[4-(2-formylphenyl)phenyl]sulfonyl-(pyridin-3-ylmethyl)amino]methyl]phenyl]phenyl]cyclohexanecarboxamide (PubChem CID 139943832) has the molecular formula C39H37N3O4S and a molecular weight of 643.81 g/mol. Its IUPAC name is N-[4-[4-[[[4-(2-formylphenyl)phenyl]sulfonyl-(pyridin-3-ylmethyl)amino]methyl]phenyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[4-[[[4-(2-formylphenyl)phenyl]sulfonyl-(pyridin-3-ylmethyl)amino]methyl]phenyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 139943832 |
| Molecular Formula | C39H37N3O4S |
| Molecular Weight | 643.81 g/mol |
| Exact Mass | 643.25 |
| IUPAC Name | N-[4-[4-[[[4-(2-formylphenyl)phenyl]sulfonyl-(pyridin-3-ylmethyl)amino]methyl]phenyl]phenyl]cyclohexanecarboxamide |
| SMILES | O=Cc1ccccc1-c1ccc(S(=O)(=O)N(Cc2ccc(-c3ccc(NC(=O)C4CCCCC4)cc3)cc2)Cc2cccnc2)cc1 |
| InChI | InChI=1S/C39H37N3O4S/c43-28-35-10-4-5-11-38(35)33-18-22-37(23-19-33)47(45,46)42(27-30-7-6-24-40-25-30)26-29-12-14-31(15-13-29)32-16-20-36(21-17-32)41-39(44)34-8-2-1-3-9-34/h4-7,10-25,28,34H,1-3,8-9,26-27H2,(H,41,44) |
| InChIKey | KCUMIBFOHQHWHP-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.81 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|