C32H26N2O5S — CID 139943896
4-[4-[[(4-phenoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]methyl]phenyl]benzoic acid (PubChem CID 139943896) has the molecular formula C32H26N2O5S and a molecular weight of 550.64 g/mol. Its IUPAC name is 4-[4-[[(4-phenoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]methyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[[(4-phenoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 139943896 |
| Molecular Formula | C32H26N2O5S |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 4-[4-[[(4-phenoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]methyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(CN(Cc3cccnc3)S(=O)(=O)c3ccc(Oc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H26N2O5S/c35-32(36)28-14-12-27(13-15-28)26-10-8-24(9-11-26)22-34(23-25-5-4-20-33-21-25)40(37,38)31-18-16-30(17-19-31)39-29-6-2-1-3-7-29/h1-21H,22-23H2,(H,35,36) |
| InChIKey | JODLAUSYBZJAHU-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |