C24H32O2 — CID 139944971
4-[4-[1-(4-hydroxyphenyl)-2,3-dimethylbutyl]cyclohexyl]phenol (PubChem CID 139944971) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is 4-[4-[1-(4-hydroxyphenyl)-2,3-dimethylbutyl]cyclohexyl]phenol.
| Compound Name | 4-[4-[1-(4-hydroxyphenyl)-2,3-dimethylbutyl]cyclohexyl]phenol |
|---|---|
| PubChem CID | 139944971 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 4-[4-[1-(4-hydroxyphenyl)-2,3-dimethylbutyl]cyclohexyl]phenol |
| SMILES | CC(C)C(C)C(c1ccc(O)cc1)C1CCC(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C24H32O2/c1-16(2)17(3)24(21-10-14-23(26)15-11-21)20-6-4-18(5-7-20)19-8-12-22(25)13-9-19/h8-18,20,24-26H,4-7H2,1-3H3 |
| InChIKey | LDKKBTDZRBAMTO-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |