C25H34O2 — CID 139945023
4-[4-[1-(4-hydroxyphenyl)-3-methylhexyl]cyclohexyl]phenol (PubChem CID 139945023) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is 4-[4-[1-(4-hydroxyphenyl)-3-methylhexyl]cyclohexyl]phenol.
| Compound Name | 4-[4-[1-(4-hydroxyphenyl)-3-methylhexyl]cyclohexyl]phenol |
|---|---|
| PubChem CID | 139945023 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 4-[4-[1-(4-hydroxyphenyl)-3-methylhexyl]cyclohexyl]phenol |
| SMILES | CCCC(C)CC(c1ccc(O)cc1)C1CCC(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C25H34O2/c1-3-4-18(2)17-25(22-11-15-24(27)16-12-22)21-7-5-19(6-8-21)20-9-13-23(26)14-10-20/h9-16,18-19,21,25-27H,3-8,17H2,1-2H3 |
| InChIKey | BSLLEXKURWDDHB-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |