C26H40O3 — CID 166687181
4-[4-[hydroxy-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]cyclohexyl]phenol (PubChem CID 166687181) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is 4-[4-[hydroxy-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]cyclohexyl]phenol.
| Compound Name | 4-[4-[hydroxy-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]cyclohexyl]phenol |
|---|---|
| PubChem CID | 166687181 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 4-[4-[hydroxy-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]cyclohexyl]phenol |
| SMILES | CC1CCC(C2CCC(C(O)OC3CCC(c4ccc(O)cc4)CC3)CC2)CC1 |
| InChI | InChI=1S/C26H40O3/c1-18-2-4-19(5-3-18)20-6-8-23(9-7-20)26(28)29-25-16-12-22(13-17-25)21-10-14-24(27)15-11-21/h10-11,14-15,18-20,22-23,25-28H,2-9,12-13,16-17H2,1H3 |
| InChIKey | POOWTYAJJYTMDG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|