C21H14F3N3O3 — CID 139946262
2-[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 139946262) has the molecular formula C21H14F3N3O3 and a molecular weight of 413.36 g/mol. Its IUPAC name is 2-[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 139946262 |
| Molecular Formula | C21H14F3N3O3 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | O=C1NCCn2c(-c3ccc(-c4ccccc4OC(F)(F)F)o3)nc3cccc1c32 |
| InChI | InChI=1S/C21H14F3N3O3/c22-21(23,24)30-16-7-2-1-4-12(16)15-8-9-17(29-15)19-26-14-6-3-5-13-18(14)27(19)11-10-25-20(13)28/h1-9H,10-11H2,(H,25,28) |
| InChIKey | PNGKTUCPPRUFGT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |