C31H38N2O4 — CID 139948034
2,4-dinitro-1-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethynyl]benzene (PubChem CID 139948034) has the molecular formula C31H38N2O4 and a molecular weight of 502.66 g/mol. Its IUPAC name is 2,4-dinitro-1-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethynyl]benzene.
| Compound Name | 2,4-dinitro-1-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 139948034 |
| Molecular Formula | C31H38N2O4 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 2,4-dinitro-1-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethynyl]benzene |
| SMILES | CCCCCC1CCC(C2CCC(c3ccc(C#Cc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])cc3)CC2)CC1 |
| InChI | InChI=1S/C31H38N2O4/c1-2-3-4-5-23-6-11-25(12-7-23)27-16-18-28(19-17-27)26-13-8-24(9-14-26)10-15-29-20-21-30(32(34)35)22-31(29)33(36)37/h8-9,13-14,20-23,25,27-28H,2-7,11-12,16-19H2,1H3 |
| InChIKey | GFZZUDOSKVNYPI-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|