About bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate
bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate (PubChem CID 139949440) has the molecular formula C12H27BiO9S3
and a molecular weight of 620.52 g/mol. Its IUPAC name is bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate.
Molecular Properties
| Compound Name | bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate |
| PubChem CID | 139949440 |
| Molecular Formula | C12H27BiO9S3 |
| Molecular Weight | 620.52 g/mol |
| Exact Mass | 620.06 |
| IUPAC Name | bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate |
| SMILES | CCC(C)S(=O)(=O)O[Bi](OS(=O)(=O)C(C)CC)OS(=O)(=O)C(C)CC |
| InChI | InChI=1S/3C4H10O3S.Bi/c3*1-3-4(2)8(5,6)7;/h3*4H,3H2,1-2H3,(H,5,6,7);/q;;;+3/p-3 |
| InChIKey | FRMCUAZXYRYBSP-UHFFFAOYSA-K |
| XLogP | 1.41 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 620.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate?
The IUPAC name of bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate (CID 139949440) is bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate.
What is the SMILES notation for bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate?
The canonical SMILES for bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate is CCC(C)S(=O)(=O)O[Bi](OS(=O)(=O)C(C)CC)OS(=O)(=O)C(C)CC.
What is the InChIKey of bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate?
The InChIKey is FRMCUAZXYRYBSP-UHFFFAOYSA-K. The full InChI is InChI=1S/3C4H10O3S.Bi/c3*1-3-4(2)8(5,6)7;/h3*4H,3H2,1-2H3,(H,5,6,7);/q;;;+3/p-3.
What are the key properties of bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate?
bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate has a molecular weight of 620.52 g/mol, XLogP of 1.41, 12 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(butan-2-ylsulfonyloxy)bismuthanyl butane-2-sulfonate is sourced from PubChem (CID 139949440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).