C22H28N4O5 — CID 139949537
3-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-2-oxo-1-bicyclo[2.2.2]octanyl]prop-2-enoic acid (PubChem CID 139949537) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is 3-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-2-oxo-1-bicyclo[2.2.2]octanyl]prop-2-enoic acid.
| Compound Name | 3-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-2-oxo-1-bicyclo[2.2.2]octanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139949537 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 3-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-2-oxo-1-bicyclo[2.2.2]octanyl]prop-2-enoic acid |
| SMILES | CCCn1c(=O)c2[nH]c(C34CCC(C=CC(=O)O)(CC3)C(=O)C4)nc2n(CCC)c1=O |
| InChI | InChI=1S/C22H28N4O5/c1-3-11-25-17-16(18(30)26(12-4-2)20(25)31)23-19(24-17)22-9-7-21(8-10-22,14(27)13-22)6-5-15(28)29/h5-6H,3-4,7-13H2,1-2H3,(H,23,24)(H,28,29) |
| InChIKey | REYLBGJRIKKSDQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|