C25H39N4O5P — CID 91459113
8-[4-(2-diethoxyphosphorylethenyl)-1-bicyclo[2.2.2]octanyl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 91459113) has the molecular formula C25H39N4O5P and a molecular weight of 506.58 g/mol. Its IUPAC name is 8-[4-(2-diethoxyphosphorylethenyl)-1-bicyclo[2.2.2]octanyl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[4-(2-diethoxyphosphorylethenyl)-1-bicyclo[2.2.2]octanyl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 91459113 |
| Molecular Formula | C25H39N4O5P |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 8-[4-(2-diethoxyphosphorylethenyl)-1-bicyclo[2.2.2]octanyl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(C34CCC(C=CP(=O)(OCC)OCC)(CC3)CC4)nc2n(CCC)c1=O |
| InChI | InChI=1S/C25H39N4O5P/c1-5-16-28-20-19(21(30)29(17-6-2)23(28)31)26-22(27-20)25-12-9-24(10-13-25,11-14-25)15-18-35(32,33-7-3)34-8-4/h15,18H,5-14,16-17H2,1-4H3,(H,26,27) |
| InChIKey | APDJHVNNJGPFBU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|