C22H29N5O2 — CID 18767654
(E)-3-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-1-bicyclo[2.2.2]octanyl]prop-2-enenitrile (PubChem CID 18767654) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is (E)-3-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-1-bicyclo[2.2.2]octanyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-1-bicyclo[2.2.2]octanyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 18767654 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | (E)-3-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-1-bicyclo[2.2.2]octanyl]prop-2-enenitrile |
| SMILES | CCCn1c(=O)c2[nH]c(C34CCC(/C=C/C#N)(CC3)CC4)nc2n(CCC)c1=O |
| InChI | InChI=1S/C22H29N5O2/c1-3-14-26-17-16(18(28)27(15-4-2)20(26)29)24-19(25-17)22-10-7-21(8-11-22,9-12-22)6-5-13-23/h5-6H,3-4,7-12,14-15H2,1-2H3,(H,24,25)/b6-5+ |
| InChIKey | PFLLLVNLSOVGBZ-AATRIKPKSA-N |
| XLogP | 3.38 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|