C36H56N2O4 — CID 139954384
5-[methyl(pentyl)amino]-1-[[2-[2-[[5-[methyl(pentyl)amino]-2-oxopentoxy]methyl]phenyl]phenyl]methoxy]pentan-2-one (PubChem CID 139954384) has the molecular formula C36H56N2O4 and a molecular weight of 580.85 g/mol. Its IUPAC name is 5-[methyl(pentyl)amino]-1-[[2-[2-[[5-[methyl(pentyl)amino]-2-oxopentoxy]methyl]phenyl]phenyl]methoxy]pentan-2-one.
| Compound Name | 5-[methyl(pentyl)amino]-1-[[2-[2-[[5-[methyl(pentyl)amino]-2-oxopentoxy]methyl]phenyl]phenyl]methoxy]pentan-2-one |
|---|---|
| PubChem CID | 139954384 |
| Molecular Formula | C36H56N2O4 |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.42 |
| IUPAC Name | 5-[methyl(pentyl)amino]-1-[[2-[2-[[5-[methyl(pentyl)amino]-2-oxopentoxy]methyl]phenyl]phenyl]methoxy]pentan-2-one |
| SMILES | CCCCCN(C)CCCC(=O)COCc1ccccc1-c1ccccc1COCC(=O)CCCN(C)CCCCC |
| InChI | InChI=1S/C36H56N2O4/c1-5-7-13-23-37(3)25-15-19-33(39)29-41-27-31-17-9-11-21-35(31)36-22-12-10-18-32(36)28-42-30-34(40)20-16-26-38(4)24-14-8-6-2/h9-12,17-18,21-22H,5-8,13-16,19-20,23-30H2,1-4H3 |
| InChIKey | WYTXNKQCOHSWMN-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|