C52H88N2O4 — CID 139954791
5-[hexyl(octyl)amino]-1-[[3-[3-[[5-[hexyl(octyl)amino]-2-oxopentoxy]methyl]phenyl]phenyl]methoxy]pentan-2-one (PubChem CID 139954791) has the molecular formula C52H88N2O4 and a molecular weight of 805.29 g/mol. Its IUPAC name is 5-[hexyl(octyl)amino]-1-[[3-[3-[[5-[hexyl(octyl)amino]-2-oxopentoxy]methyl]phenyl]phenyl]methoxy]pentan-2-one.
| Compound Name | 5-[hexyl(octyl)amino]-1-[[3-[3-[[5-[hexyl(octyl)amino]-2-oxopentoxy]methyl]phenyl]phenyl]methoxy]pentan-2-one |
|---|---|
| PubChem CID | 139954791 |
| Molecular Formula | C52H88N2O4 |
| Molecular Weight | 805.29 g/mol |
| Exact Mass | 804.67 |
| IUPAC Name | 5-[hexyl(octyl)amino]-1-[[3-[3-[[5-[hexyl(octyl)amino]-2-oxopentoxy]methyl]phenyl]phenyl]methoxy]pentan-2-one |
| SMILES | CCCCCCCCN(CCCCCC)CCCC(=O)COCc1cccc(-c2cccc(COCC(=O)CCCN(CCCCCC)CCCCCCCC)c2)c1 |
| InChI | InChI=1S/C52H88N2O4/c1-5-9-13-17-19-23-37-53(35-21-15-11-7-3)39-27-33-51(55)45-57-43-47-29-25-31-49(41-47)50-32-26-30-48(42-50)44-58-46-52(56)34-28-40-54(36-22-16-12-8-4)38-24-20-18-14-10-6-2/h25-26,29-32,41-42H,5-24,27-28,33-40,43-46H2,1-4H3 |
| InChIKey | ZIQGNTYQQKEFEU-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.29 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|