C44H72N2O4 — CID 139955664
5-(dipentylamino)-1-[[3-[3-[[5-(dipentylamino)-2-oxopentoxy]methyl]phenyl]phenyl]methoxy]pentan-2-one (PubChem CID 139955664) has the molecular formula C44H72N2O4 and a molecular weight of 693.07 g/mol. Its IUPAC name is 5-(dipentylamino)-1-[[3-[3-[[5-(dipentylamino)-2-oxopentoxy]methyl]phenyl]phenyl]methoxy]pentan-2-one.
| Compound Name | 5-(dipentylamino)-1-[[3-[3-[[5-(dipentylamino)-2-oxopentoxy]methyl]phenyl]phenyl]methoxy]pentan-2-one |
|---|---|
| PubChem CID | 139955664 |
| Molecular Formula | C44H72N2O4 |
| Molecular Weight | 693.07 g/mol |
| Exact Mass | 692.55 |
| IUPAC Name | 5-(dipentylamino)-1-[[3-[3-[[5-(dipentylamino)-2-oxopentoxy]methyl]phenyl]phenyl]methoxy]pentan-2-one |
| SMILES | CCCCCN(CCCCC)CCCC(=O)COCc1cccc(-c2cccc(COCC(=O)CCCN(CCCCC)CCCCC)c2)c1 |
| InChI | InChI=1S/C44H72N2O4/c1-5-9-13-27-45(28-14-10-6-2)31-19-25-43(47)37-49-35-39-21-17-23-41(33-39)42-24-18-22-40(34-42)36-50-38-44(48)26-20-32-46(29-15-11-7-3)30-16-12-8-4/h17-18,21-24,33-34H,5-16,19-20,25-32,35-38H2,1-4H3 |
| InChIKey | IPQHJARUEZZQMW-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.07 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|