C24H28Cl2O4 — CID 139956007
5-chloro-1-[[3-[3-[(5-chloro-2-oxopentoxy)methyl]phenyl]phenyl]methoxy]pentan-2-one (PubChem CID 139956007) has the molecular formula C24H28Cl2O4 and a molecular weight of 451.39 g/mol. Its IUPAC name is 5-chloro-1-[[3-[3-[(5-chloro-2-oxopentoxy)methyl]phenyl]phenyl]methoxy]pentan-2-one.
| Compound Name | 5-chloro-1-[[3-[3-[(5-chloro-2-oxopentoxy)methyl]phenyl]phenyl]methoxy]pentan-2-one |
|---|---|
| PubChem CID | 139956007 |
| Molecular Formula | C24H28Cl2O4 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 5-chloro-1-[[3-[3-[(5-chloro-2-oxopentoxy)methyl]phenyl]phenyl]methoxy]pentan-2-one |
| SMILES | O=C(CCCCl)COCc1cccc(-c2cccc(COCC(=O)CCCCl)c2)c1 |
| InChI | InChI=1S/C24H28Cl2O4/c25-11-3-9-23(27)17-29-15-19-5-1-7-21(13-19)22-8-2-6-20(14-22)16-30-18-24(28)10-4-12-26/h1-2,5-8,13-14H,3-4,9-12,15-18H2 |
| InChIKey | XGPWJYHPAAQDTA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|