C19H20I2N2O2 — CID 139955285
3-iodo-N-[3-[[3-(3-iodopropanoylamino)phenyl]methyl]phenyl]propanamide (PubChem CID 139955285) has the molecular formula C19H20I2N2O2 and a molecular weight of 562.19 g/mol. Its IUPAC name is 3-iodo-N-[3-[[3-(3-iodopropanoylamino)phenyl]methyl]phenyl]propanamide.
| Compound Name | 3-iodo-N-[3-[[3-(3-iodopropanoylamino)phenyl]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 139955285 |
| Molecular Formula | C19H20I2N2O2 |
| Molecular Weight | 562.19 g/mol |
| Exact Mass | 561.96 |
| IUPAC Name | 3-iodo-N-[3-[[3-(3-iodopropanoylamino)phenyl]methyl]phenyl]propanamide |
| SMILES | O=C(CCI)Nc1cccc(Cc2cccc(NC(=O)CCI)c2)c1 |
| InChI | InChI=1S/C19H20I2N2O2/c20-9-7-18(24)22-16-5-1-3-14(12-16)11-15-4-2-6-17(13-15)23-19(25)8-10-21/h1-6,12-13H,7-11H2,(H,22,24)(H,23,25) |
| InChIKey | LVWLYMQZSOHTNC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.19 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|