C28H44N2O2 — CID 139955839
N-methyl-N-[[3-[3-[[methyl(pentyl)amino]methoxymethyl]phenyl]phenyl]methoxymethyl]pentan-1-amine (PubChem CID 139955839) has the molecular formula C28H44N2O2 and a molecular weight of 440.67 g/mol. Its IUPAC name is N-methyl-N-[[3-[3-[[methyl(pentyl)amino]methoxymethyl]phenyl]phenyl]methoxymethyl]pentan-1-amine.
| Compound Name | N-methyl-N-[[3-[3-[[methyl(pentyl)amino]methoxymethyl]phenyl]phenyl]methoxymethyl]pentan-1-amine |
|---|---|
| PubChem CID | 139955839 |
| Molecular Formula | C28H44N2O2 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.34 |
| IUPAC Name | N-methyl-N-[[3-[3-[[methyl(pentyl)amino]methoxymethyl]phenyl]phenyl]methoxymethyl]pentan-1-amine |
| SMILES | CCCCCN(C)COCc1cccc(-c2cccc(COCN(C)CCCCC)c2)c1 |
| InChI | InChI=1S/C28H44N2O2/c1-5-7-9-17-29(3)23-31-21-25-13-11-15-27(19-25)28-16-12-14-26(20-28)22-32-24-30(4)18-10-8-6-2/h11-16,19-20H,5-10,17-18,21-24H2,1-4H3 |
| InChIKey | YUFHHQRJGXNOGA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|