C27H17F15O4S2 — CID 139958787
[(4-methoxyphenyl)-diphenyl-λ4-sulfanyl] 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonate (PubChem CID 139958787) has the molecular formula C27H17F15O4S2 and a molecular weight of 754.53 g/mol. Its IUPAC name is [(4-methoxyphenyl)-diphenyl-λ4-sulfanyl] 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonate.
| Compound Name | [(4-methoxyphenyl)-diphenyl-λ4-sulfanyl] 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonate |
|---|---|
| PubChem CID | 139958787 |
| Molecular Formula | C27H17F15O4S2 |
| Molecular Weight | 754.53 g/mol |
| Exact Mass | 754.03 |
| IUPAC Name | [(4-methoxyphenyl)-diphenyl-λ4-sulfanyl] 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonate |
| SMILES | COc1ccc(S(OS(=O)(=O)C2(F)C(F)(F)C(F)(F)C(F)(C(F)(F)C(F)(F)F)C(F)(F)C2(F)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H17F15O4S2/c1-45-16-12-14-19(15-13-16)47(17-8-4-2-5-9-17,18-10-6-3-7-11-18)46-48(43,44)26(39)24(35,36)21(29,30)20(28,22(31,32)25(26,37)38)23(33,34)27(40,41)42/h2-15H,1H3 |
| InChIKey | AJDGZAMYLYWIBL-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.53 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|