C29H21F15O6S2 — CID 139958793
[tris(4-methoxyphenyl)-λ4-sulfanyl] 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonate (PubChem CID 139958793) has the molecular formula C29H21F15O6S2 and a molecular weight of 814.58 g/mol. Its IUPAC name is [tris(4-methoxyphenyl)-λ4-sulfanyl] 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonate.
| Compound Name | [tris(4-methoxyphenyl)-λ4-sulfanyl] 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonate |
|---|---|
| PubChem CID | 139958793 |
| Molecular Formula | C29H21F15O6S2 |
| Molecular Weight | 814.58 g/mol |
| Exact Mass | 814.05 |
| IUPAC Name | [tris(4-methoxyphenyl)-λ4-sulfanyl] 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonate |
| SMILES | COc1ccc(S(OS(=O)(=O)C2(F)C(F)(F)C(F)(F)C(F)(C(F)(F)C(F)(F)F)C(F)(F)C2(F)F)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H21F15O6S2/c1-47-16-4-10-19(11-5-16)51(20-12-6-17(48-2)7-13-20,21-14-8-18(49-3)9-15-21)50-52(45,46)28(41)26(37,38)23(31,32)22(30,24(33,34)27(28,39)40)25(35,36)29(42,43)44/h4-15H,1-3H3 |
| InChIKey | QNWLMAJKHBTTLE-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.58 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|