C26H21F5 — CID 139961858
2,6-bis(4-ethyl-2,3-difluorophenyl)-7-fluoro-1,4-dihydronaphthalene (PubChem CID 139961858) has the molecular formula C26H21F5 and a molecular weight of 428.44 g/mol. Its IUPAC name is 2,6-bis(4-ethyl-2,3-difluorophenyl)-7-fluoro-1,4-dihydronaphthalene.
| Compound Name | 2,6-bis(4-ethyl-2,3-difluorophenyl)-7-fluoro-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 139961858 |
| Molecular Formula | C26H21F5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2,6-bis(4-ethyl-2,3-difluorophenyl)-7-fluoro-1,4-dihydronaphthalene |
| SMILES | CCc1ccc(C2=CCc3cc(-c4ccc(CC)c(F)c4F)c(F)cc3C2)c(F)c1F |
| InChI | InChI=1S/C26H21F5/c1-3-14-7-9-19(25(30)23(14)28)17-6-5-16-12-21(22(27)13-18(16)11-17)20-10-8-15(4-2)24(29)26(20)31/h6-10,12-13H,3-5,11H2,1-2H3 |
| InChIKey | KHAGYIXOIQPJKC-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |