C18H24O5 — CID 139962532
7-[(3Z)-3-[[(3Z)-3-[[(3Z)-3-propylideneoxiran-2-yl]methylidene]oxiran-2-yl]methylidene]oxiran-2-yl]heptanoic acid (PubChem CID 139962532) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is 7-[(3Z)-3-[[(3Z)-3-[[(3Z)-3-propylideneoxiran-2-yl]methylidene]oxiran-2-yl]methylidene]oxiran-2-yl]heptanoic acid.
| Compound Name | 7-[(3Z)-3-[[(3Z)-3-[[(3Z)-3-propylideneoxiran-2-yl]methylidene]oxiran-2-yl]methylidene]oxiran-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 139962532 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 7-[(3Z)-3-[[(3Z)-3-[[(3Z)-3-propylideneoxiran-2-yl]methylidene]oxiran-2-yl]methylidene]oxiran-2-yl]heptanoic acid |
| SMILES | CC/C=C1\OC1/C=C1\OC1/C=C1\OC1CCCCCCC(=O)O |
| InChI | InChI=1S/C18H24O5/c1-2-7-12-14(21-12)10-16-17(23-16)11-15-13(22-15)8-5-3-4-6-9-18(19)20/h7,10-11,13-14,17H,2-6,8-9H2,1H3,(H,19,20)/b12-7-,15-11-,16-10- |
| InChIKey | QYABEZOHXYMBGX-WNPJJMPNSA-N |
| XLogP | 3.67 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|