About hexadecanoic acid;molecular hydrogen;hydrochloride
hexadecanoic acid;molecular hydrogen;hydrochloride (PubChem CID 173258662) has the molecular formula C16H35ClO2
and a molecular weight of 294.91 g/mol. Its IUPAC name is hexadecanoic acid;molecular hydrogen;hydrochloride.
Molecular Properties
| Compound Name | hexadecanoic acid;molecular hydrogen;hydrochloride |
| PubChem CID | 173258662 |
| Molecular Formula | C16H35ClO2 |
| Molecular Weight | 294.91 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | hexadecanoic acid;molecular hydrogen;hydrochloride |
| SMILES | CCCCCCCCCCCCCCCC(=O)O.Cl.[H][H] |
| InChI | InChI=1S/C16H32O2.ClH.H2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;;/h2-15H2,1H3,(H,17,18);2*1H |
| InChIKey | FMSCIUHSSUGDRU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.91 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecanoic acid;molecular hydrogen;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecanoic acid;molecular hydrogen;hydrochloride?
The IUPAC name of hexadecanoic acid;molecular hydrogen;hydrochloride (CID 173258662) is hexadecanoic acid;molecular hydrogen;hydrochloride.
What is the SMILES notation for hexadecanoic acid;molecular hydrogen;hydrochloride?
The canonical SMILES for hexadecanoic acid;molecular hydrogen;hydrochloride is CCCCCCCCCCCCCCCC(=O)O.Cl.[H][H].
What is the InChIKey of hexadecanoic acid;molecular hydrogen;hydrochloride?
The InChIKey is FMSCIUHSSUGDRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2.ClH.H2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;;/h2-15H2,1H3,(H,17,18);2*1H.
What are the key properties of hexadecanoic acid;molecular hydrogen;hydrochloride?
hexadecanoic acid;molecular hydrogen;hydrochloride has a molecular weight of 294.91 g/mol, XLogP of 6.22, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecanoic acid;molecular hydrogen;hydrochloride is sourced from PubChem (CID 173258662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).