C39H56 — CID 139962811
2-(2-methylpropyl)-1-[2-[2-(2-methylpropyl)-4-pentyl-1H-inden-1-yl]propan-2-yl]-4-pentyl-1H-indene (PubChem CID 139962811) has the molecular formula C39H56 and a molecular weight of 524.88 g/mol. Its IUPAC name is 2-(2-methylpropyl)-1-[2-[2-(2-methylpropyl)-4-pentyl-1H-inden-1-yl]propan-2-yl]-4-pentyl-1H-indene.
| Compound Name | 2-(2-methylpropyl)-1-[2-[2-(2-methylpropyl)-4-pentyl-1H-inden-1-yl]propan-2-yl]-4-pentyl-1H-indene |
|---|---|
| PubChem CID | 139962811 |
| Molecular Formula | C39H56 |
| Molecular Weight | 524.88 g/mol |
| Exact Mass | 524.44 |
| IUPAC Name | 2-(2-methylpropyl)-1-[2-[2-(2-methylpropyl)-4-pentyl-1H-inden-1-yl]propan-2-yl]-4-pentyl-1H-indene |
| SMILES | CCCCCc1cccc2c1C=C(CC(C)C)C2C(C)(C)C1C(CC(C)C)=Cc2c(CCCCC)cccc21 |
| InChI | InChI=1S/C39H56/c1-9-11-13-17-29-19-15-21-33-35(29)25-31(23-27(3)4)37(33)39(7,8)38-32(24-28(5)6)26-36-30(18-14-12-10-2)20-16-22-34(36)38/h15-16,19-22,25-28,37-38H,9-14,17-18,23-24H2,1-8H3 |
| InChIKey | FLMSVMWWEDNIRX-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.88 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|