C27H37N3O5 — CID 139965418
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[1-[2-(4-phenylmethoxyphenyl)acetyl]pyrrolidin-2-yl]acetamide (PubChem CID 139965418) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[1-[2-(4-phenylmethoxyphenyl)acetyl]pyrrolidin-2-yl]acetamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[1-[2-(4-phenylmethoxyphenyl)acetyl]pyrrolidin-2-yl]acetamide |
|---|---|
| PubChem CID | 139965418 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[1-[2-(4-phenylmethoxyphenyl)acetyl]pyrrolidin-2-yl]acetamide |
| SMILES | NCCOCCOCCNC(=O)CC1CCCN1C(=O)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H37N3O5/c28-12-15-33-17-18-34-16-13-29-26(31)20-24-7-4-14-30(24)27(32)19-22-8-10-25(11-9-22)35-21-23-5-2-1-3-6-23/h1-3,5-6,8-11,24H,4,7,12-21,28H2,(H,29,31) |
| InChIKey | CTJFEPHZOYQCLA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|