C26H35N3O5S — CID 139965376
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[3-[2-(4-phenylmethoxyphenyl)acetyl]-1,3-thiazolidin-4-yl]acetamide (PubChem CID 139965376) has the molecular formula C26H35N3O5S and a molecular weight of 501.65 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[3-[2-(4-phenylmethoxyphenyl)acetyl]-1,3-thiazolidin-4-yl]acetamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[3-[2-(4-phenylmethoxyphenyl)acetyl]-1,3-thiazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 139965376 |
| Molecular Formula | C26H35N3O5S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[3-[2-(4-phenylmethoxyphenyl)acetyl]-1,3-thiazolidin-4-yl]acetamide |
| SMILES | NCCOCCOCCNC(=O)CC1CSCN1C(=O)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H35N3O5S/c27-10-12-32-14-15-33-13-11-28-25(30)17-23-19-35-20-29(23)26(31)16-21-6-8-24(9-7-21)34-18-22-4-2-1-3-5-22/h1-9,23H,10-20,27H2,(H,28,30) |
| InChIKey | NCXNUBBVGRCOJM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|