C28H39N3O3S — CID 139965399
N-methyl-N-[6-(methylamino)hexyl]-2-[3-[2-(4-phenylmethoxyphenyl)acetyl]-1,3-thiazolidin-4-yl]acetamide (PubChem CID 139965399) has the molecular formula C28H39N3O3S and a molecular weight of 497.71 g/mol. Its IUPAC name is N-methyl-N-[6-(methylamino)hexyl]-2-[3-[2-(4-phenylmethoxyphenyl)acetyl]-1,3-thiazolidin-4-yl]acetamide.
| Compound Name | N-methyl-N-[6-(methylamino)hexyl]-2-[3-[2-(4-phenylmethoxyphenyl)acetyl]-1,3-thiazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 139965399 |
| Molecular Formula | C28H39N3O3S |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | N-methyl-N-[6-(methylamino)hexyl]-2-[3-[2-(4-phenylmethoxyphenyl)acetyl]-1,3-thiazolidin-4-yl]acetamide |
| SMILES | CNCCCCCCN(C)C(=O)CC1CSCN1C(=O)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H39N3O3S/c1-29-16-8-3-4-9-17-30(2)27(32)19-25-21-35-22-31(25)28(33)18-23-12-14-26(15-13-23)34-20-24-10-6-5-7-11-24/h5-7,10-15,25,29H,3-4,8-9,16-22H2,1-2H3 |
| InChIKey | UMSPGLPHKGWWDA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|