C9H9F4N — CID 139965885
N-methyl-1-(2,3,4,6-tetrafluorophenyl)ethanamine (PubChem CID 139965885) has the molecular formula C9H9F4N and a molecular weight of 207.17 g/mol. Its IUPAC name is N-methyl-1-(2,3,4,6-tetrafluorophenyl)ethanamine.
| Compound Name | N-methyl-1-(2,3,4,6-tetrafluorophenyl)ethanamine |
|---|---|
| PubChem CID | 139965885 |
| Molecular Formula | C9H9F4N |
| Molecular Weight | 207.17 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | N-methyl-1-(2,3,4,6-tetrafluorophenyl)ethanamine |
| SMILES | CNC(C)c1c(F)cc(F)c(F)c1F |
| InChI | InChI=1S/C9H9F4N/c1-4(14-2)7-5(10)3-6(11)8(12)9(7)13/h3-4,14H,1-2H3 |
| InChIKey | MOIZEWNUGUKZQX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.17 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|