C15H26O5 — CID 139966371
[1-(1,3-dioxolan-2-yl)-3-methylheptan-2-yl] 2-methylprop-2-eneperoxoate (PubChem CID 139966371) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is [1-(1,3-dioxolan-2-yl)-3-methylheptan-2-yl] 2-methylprop-2-eneperoxoate.
| Compound Name | [1-(1,3-dioxolan-2-yl)-3-methylheptan-2-yl] 2-methylprop-2-eneperoxoate |
|---|---|
| PubChem CID | 139966371 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [1-(1,3-dioxolan-2-yl)-3-methylheptan-2-yl] 2-methylprop-2-eneperoxoate |
| SMILES | C=C(C)C(=O)OOC(CC1OCCO1)C(C)CCCC |
| InChI | InChI=1S/C15H26O5/c1-5-6-7-12(4)13(10-14-17-8-9-18-14)19-20-15(16)11(2)3/h12-14H,2,5-10H2,1,3-4H3 |
| InChIKey | XMVNULSHWGYBEI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|