C11H18O6 — CID 88655933
1-butoxycarbonyloxyethyl 2-methylprop-2-eneperoxoate (PubChem CID 88655933) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is 1-butoxycarbonyloxyethyl 2-methylprop-2-eneperoxoate.
| Compound Name | 1-butoxycarbonyloxyethyl 2-methylprop-2-eneperoxoate |
|---|---|
| PubChem CID | 88655933 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-butoxycarbonyloxyethyl 2-methylprop-2-eneperoxoate |
| SMILES | C=C(C)C(=O)OOC(C)OC(=O)OCCCC |
| InChI | InChI=1S/C11H18O6/c1-5-6-7-14-11(13)15-9(4)16-17-10(12)8(2)3/h9H,2,5-7H2,1,3-4H3 |
| InChIKey | OIKUBBMJYWUDCK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|