C17H30O3 — CID 139968055
(E,2S,7S)-2,6-dimethyl-4-methylidene-7-(oxan-2-yloxy)non-5-en-1-ol (PubChem CID 139968055) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (E,2S,7S)-2,6-dimethyl-4-methylidene-7-(oxan-2-yloxy)non-5-en-1-ol.
| Compound Name | (E,2S,7S)-2,6-dimethyl-4-methylidene-7-(oxan-2-yloxy)non-5-en-1-ol |
|---|---|
| PubChem CID | 139968055 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (E,2S,7S)-2,6-dimethyl-4-methylidene-7-(oxan-2-yloxy)non-5-en-1-ol |
| SMILES | C=C(/C=C(\C)[C@H](CC)OC1CCCCO1)C[C@H](C)CO |
| InChI | InChI=1S/C17H30O3/c1-5-16(20-17-8-6-7-9-19-17)15(4)11-13(2)10-14(3)12-18/h11,14,16-18H,2,5-10,12H2,1,3-4H3/b15-11+/t14-,16-,17?/m0/s1 |
| InChIKey | NTANNEVLHFYZJX-DKTXXXPESA-N |
| XLogP | 3.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|