C18H24O4 — CID 139968515
ethyl (1Z)-1-(1-ethoxy-1-oxopropan-2-ylidene)-7a-methyl-6,7-dihydro-2H-indene-4-carboxylate (PubChem CID 139968515) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is ethyl (1Z)-1-(1-ethoxy-1-oxopropan-2-ylidene)-7a-methyl-6,7-dihydro-2H-indene-4-carboxylate.
| Compound Name | ethyl (1Z)-1-(1-ethoxy-1-oxopropan-2-ylidene)-7a-methyl-6,7-dihydro-2H-indene-4-carboxylate |
|---|---|
| PubChem CID | 139968515 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | ethyl (1Z)-1-(1-ethoxy-1-oxopropan-2-ylidene)-7a-methyl-6,7-dihydro-2H-indene-4-carboxylate |
| SMILES | CCOC(=O)C1=CCCC2(C)C1=CC/C2=C(\C)C(=O)OCC |
| InChI | InChI=1S/C18H24O4/c1-5-21-16(19)12(3)14-9-10-15-13(17(20)22-6-2)8-7-11-18(14,15)4/h8,10H,5-7,9,11H2,1-4H3/b14-12- |
| InChIKey | MXYOVARHGUSGSW-OWBHPGMISA-N |
| XLogP | 3.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|