C37H42O6P2 — CID 139969616
3,9-bis[(2,4,6-trimethyl-3-phenylphenyl)methyl]-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide (PubChem CID 139969616) has the molecular formula C37H42O6P2 and a molecular weight of 644.69 g/mol. Its IUPAC name is 3,9-bis[(2,4,6-trimethyl-3-phenylphenyl)methyl]-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide.
| Compound Name | 3,9-bis[(2,4,6-trimethyl-3-phenylphenyl)methyl]-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide |
|---|---|
| PubChem CID | 139969616 |
| Molecular Formula | C37H42O6P2 |
| Molecular Weight | 644.69 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | 3,9-bis[(2,4,6-trimethyl-3-phenylphenyl)methyl]-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide |
| SMILES | Cc1cc(C)c(-c2ccccc2)c(C)c1CP1(=O)OCC2(CO1)COP(=O)(Cc1c(C)cc(C)c(-c3ccccc3)c1C)OC2 |
| InChI | InChI=1S/C37H42O6P2/c1-25-17-27(3)35(31-13-9-7-10-14-31)29(5)33(25)19-44(38)40-21-37(22-41-44)23-42-45(39,43-24-37)20-34-26(2)18-28(4)36(30(34)6)32-15-11-8-12-16-32/h7-18H,19-24H2,1-6H3 |
| InChIKey | FSIBZUPDPHDUAC-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.69 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|