C21H24N3O3S+ — CID 1399702
2-[[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetic acid (PubChem CID 1399702) has the molecular formula C21H24N3O3S+ and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 1399702 |
| Molecular Formula | C21H24N3O3S+ |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-(4-methoxyphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetic acid |
| SMILES | COc1ccc(-[n+]2c(SCC(=O)O)n[nH]c2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-21(2,3)15-7-5-14(6-8-15)19-22-23-20(28-13-18(25)26)24(19)16-9-11-17(27-4)12-10-16/h5-12H,13H2,1-4H3,(H,25,26)/p+1 |
| InChIKey | YWUWFKXJDAVCET-UHFFFAOYSA-O |
| XLogP | 3.84 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|