C106H82O8P4 — CID 139970588
tetrakis(tetraphenyl-λ5-phosphanyl) benzene-1,2,4,5-tetracarboxylate (PubChem CID 139970588) has the molecular formula C106H82O8P4 and a molecular weight of 1607.71 g/mol. Its IUPAC name is tetrakis(tetraphenyl-λ5-phosphanyl) benzene-1,2,4,5-tetracarboxylate.
| Compound Name | tetrakis(tetraphenyl-λ5-phosphanyl) benzene-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 139970588 |
| Molecular Formula | C106H82O8P4 |
| Molecular Weight | 1607.71 g/mol |
| Exact Mass | 1606.50 |
| IUPAC Name | tetrakis(tetraphenyl-λ5-phosphanyl) benzene-1,2,4,5-tetracarboxylate |
| SMILES | O=C(OP(c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1)c1cc(C(=O)OP(c2ccccc2)(c2ccccc2)(c2ccccc2)c2ccccc2)c(C(=O)OP(c2ccccc2)(c2ccccc2)(c2ccccc2)c2ccccc2)cc1C(=O)OP(c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C106H82O8P4/c107-103(111-115(83-49-17-1-18-50-83,84-51-19-2-20-52-84,85-53-21-3-22-54-85)86-55-23-4-24-56-86)99-81-101(105(109)113-117(91-65-33-9-34-66-91,92-67-35-10-36-68-92,93-69-37-11-38-70-93)94-71-39-12-40-72-94)102(106(110)114-118(95-73-41-13-42-74-95,96-75-43-14-44-76-96,97-77-45-15-46-78-97)98-79-47-16-48-80-98)82-100(99)104(108)112-116(87-57-25-5-26-58-87,88-59-27-6-28-60-88,89-61-29-7-30-62-89)90-63-31-8-32-64-90/h1-82H |
| InChIKey | GNOFYRJREISXPZ-UHFFFAOYSA-N |
| XLogP | 17.40 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 118 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1607.71 |
| LogP ≤ 5 | 17.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|