C18H33NO3Si — CID 139971872
tert-butyl 3-prop-2-enyl-3-trimethylsilyloxy-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 139971872) has the molecular formula C18H33NO3Si and a molecular weight of 339.55 g/mol. Its IUPAC name is tert-butyl 3-prop-2-enyl-3-trimethylsilyloxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-prop-2-enyl-3-trimethylsilyloxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 139971872 |
| Molecular Formula | C18H33NO3Si |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | tert-butyl 3-prop-2-enyl-3-trimethylsilyloxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C=CCC1(O[Si](C)(C)C)CC2CCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO3Si/c1-8-11-18(22-23(5,6)7)12-14-9-10-15(13-18)19(14)16(20)21-17(2,3)4/h8,14-15H,1,9-13H2,2-7H3 |
| InChIKey | MWXJBSCUCYQZAM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|