C23H43NO3Si — CID 154710197
ethyl 3-hydroxy-3-[(E)-4-tri(propan-2-yl)silylbut-2-enyl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 154710197) has the molecular formula C23H43NO3Si and a molecular weight of 409.69 g/mol. Its IUPAC name is ethyl 3-hydroxy-3-[(E)-4-tri(propan-2-yl)silylbut-2-enyl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | ethyl 3-hydroxy-3-[(E)-4-tri(propan-2-yl)silylbut-2-enyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 154710197 |
| Molecular Formula | C23H43NO3Si |
| Molecular Weight | 409.69 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | ethyl 3-hydroxy-3-[(E)-4-tri(propan-2-yl)silylbut-2-enyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCOC(=O)N1C2CCC1CC(O)(C/C=C/C[Si](C(C)C)(C(C)C)C(C)C)C2 |
| InChI | InChI=1S/C23H43NO3Si/c1-8-27-22(25)24-20-11-12-21(24)16-23(26,15-20)13-9-10-14-28(17(2)3,18(4)5)19(6)7/h9-10,17-21,26H,8,11-16H2,1-7H3/b10-9+ |
| InChIKey | VLSKLCCPVNSBIR-MDZDMXLPSA-N |
| XLogP | 6.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.69 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|