C17H31NO3Si — CID 171952270
tert-butyl 3-hydroxy-3-(1-trimethylsilylethenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171952270) has the molecular formula C17H31NO3Si and a molecular weight of 325.53 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-(1-trimethylsilylethenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-(1-trimethylsilylethenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171952270 |
| Molecular Formula | C17H31NO3Si |
| Molecular Weight | 325.53 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | tert-butyl 3-hydroxy-3-(1-trimethylsilylethenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C=C(C1(O)CC2CCC(C1)N2C(=O)OC(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H31NO3Si/c1-12(22(5,6)7)17(20)10-13-8-9-14(11-17)18(13)15(19)21-16(2,3)4/h13-14,20H,1,8-11H2,2-7H3 |
| InChIKey | PXGUZCQMXYIWEP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|