C11H17NO — CID 139972799
6-(diethylaminomethylidene)cyclohexa-2,4-dien-1-ol (PubChem CID 139972799) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 6-(diethylaminomethylidene)cyclohexa-2,4-dien-1-ol.
| Compound Name | 6-(diethylaminomethylidene)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 139972799 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 6-(diethylaminomethylidene)cyclohexa-2,4-dien-1-ol |
| SMILES | CCN(C=C1C=CC=CC1O)CC |
| InChI | InChI=1S/C11H17NO/c1-3-12(4-2)9-10-7-5-6-8-11(10)13/h5-9,11,13H,3-4H2,1-2H3 |
| InChIKey | ISMGASBMEMTCTL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |