C13H27P — CID 139972828
[4,4-dimethyl-3-(2-methylbutan-2-yl)hex-2-enyl]phosphane (PubChem CID 139972828) has the molecular formula C13H27P and a molecular weight of 214.33 g/mol. Its IUPAC name is [4,4-dimethyl-3-(2-methylbutan-2-yl)hex-2-enyl]phosphane.
| Compound Name | [4,4-dimethyl-3-(2-methylbutan-2-yl)hex-2-enyl]phosphane |
|---|---|
| PubChem CID | 139972828 |
| Molecular Formula | C13H27P |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | [4,4-dimethyl-3-(2-methylbutan-2-yl)hex-2-enyl]phosphane |
| SMILES | CCC(C)(C)C(=CCP)C(C)(C)CC |
| InChI | InChI=1S/C13H27P/c1-7-12(3,4)11(9-10-14)13(5,6)8-2/h9H,7-8,10,14H2,1-6H3 |
| InChIKey | ISBFVQYGHPNCHA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|