C13H20N2O4 — CID 139972910
3-(4-methyl-2,3-dioxopiperazin-1-yl)butan-2-yl 2-methylprop-2-enoate (PubChem CID 139972910) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-(4-methyl-2,3-dioxopiperazin-1-yl)butan-2-yl 2-methylprop-2-enoate.
| Compound Name | 3-(4-methyl-2,3-dioxopiperazin-1-yl)butan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139972910 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-(4-methyl-2,3-dioxopiperazin-1-yl)butan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)C(C)N1CCN(C)C(=O)C1=O |
| InChI | InChI=1S/C13H20N2O4/c1-8(2)13(18)19-10(4)9(3)15-7-6-14(5)11(16)12(15)17/h9-10H,1,6-7H2,2-5H3 |
| InChIKey | MPYQVQKLGXNLRP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|