C23H33NO2 — CID 139974253
benzylazanium;hexadeca-3,5-diynoate (PubChem CID 139974253) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is benzylazanium;hexadeca-3,5-diynoate.
| Compound Name | benzylazanium;hexadeca-3,5-diynoate |
|---|---|
| PubChem CID | 139974253 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | benzylazanium;hexadeca-3,5-diynoate |
| SMILES | CCCCCCCCCCC#CC#CCC(=O)[O-].[NH3+]Cc1ccccc1 |
| InChI | InChI=1S/C16H24O2.C7H9N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;8-6-7-4-2-1-3-5-7/h2-10,15H2,1H3,(H,17,18);1-5H,6,8H2 |
| InChIKey | IOIYOYPYYLPELH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|