C23H34O3 — CID 139974601
2-(4-hydroxycycloheptyl)propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 139974601) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 2-(4-hydroxycycloheptyl)propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | 2-(4-hydroxycycloheptyl)propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 139974601 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2-(4-hydroxycycloheptyl)propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | CC(C)(OC(=O)C1CC2CC1C1C3C=CC(C3)C21)C1CCCC(O)CC1 |
| InChI | InChI=1S/C23H34O3/c1-23(2,16-4-3-5-17(24)9-8-16)26-22(25)19-12-15-11-18(19)21-14-7-6-13(10-14)20(15)21/h6-7,13-21,24H,3-5,8-12H2,1-2H3 |
| InChIKey | KHYOOOHPGVDQSV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|