C24H21ClFN9 — CID 139976141
2-N-(3-chloro-2-fluorophenyl)-4-N,6-N-bis(1-pyridin-4-ylethylideneamino)pyrimidine-2,4,6-triamine (PubChem CID 139976141) has the molecular formula C24H21ClFN9 and a molecular weight of 489.95 g/mol. Its IUPAC name is 2-N-(3-chloro-2-fluorophenyl)-4-N,6-N-bis(1-pyridin-4-ylethylideneamino)pyrimidine-2,4,6-triamine.
| Compound Name | 2-N-(3-chloro-2-fluorophenyl)-4-N,6-N-bis(1-pyridin-4-ylethylideneamino)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976141 |
| Molecular Formula | C24H21ClFN9 |
| Molecular Weight | 489.95 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 2-N-(3-chloro-2-fluorophenyl)-4-N,6-N-bis(1-pyridin-4-ylethylideneamino)pyrimidine-2,4,6-triamine |
| SMILES | CC(=NNc1cc(NN=C(C)c2ccncc2)nc(Nc2cccc(Cl)c2F)n1)c1ccncc1 |
| InChI | InChI=1S/C24H21ClFN9/c1-15(17-6-10-27-11-7-17)32-34-21-14-22(35-33-16(2)18-8-12-28-13-9-18)31-24(30-21)29-20-5-3-4-19(25)23(20)26/h3-14H,1-2H3,(H3,29,30,31,34,35) |
| InChIKey | BOJSGQAKIWGXQP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.95 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|