C30H35N9 — CID 139976678
2-N,4-N-bis[1-[3-(dimethylamino)phenyl]ethylideneamino]-6-N-phenylpyrimidine-2,4,6-triamine (PubChem CID 139976678) has the molecular formula C30H35N9 and a molecular weight of 521.67 g/mol. Its IUPAC name is 2-N,4-N-bis[1-[3-(dimethylamino)phenyl]ethylideneamino]-6-N-phenylpyrimidine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis[1-[3-(dimethylamino)phenyl]ethylideneamino]-6-N-phenylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976678 |
| Molecular Formula | C30H35N9 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 2-N,4-N-bis[1-[3-(dimethylamino)phenyl]ethylideneamino]-6-N-phenylpyrimidine-2,4,6-triamine |
| SMILES | CC(=NNc1cc(Nc2ccccc2)nc(NN=C(C)c2cccc(N(C)C)c2)n1)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C30H35N9/c1-21(23-12-10-16-26(18-23)38(3)4)34-36-29-20-28(31-25-14-8-7-9-15-25)32-30(33-29)37-35-22(2)24-13-11-17-27(19-24)39(5)6/h7-20H,1-6H3,(H3,31,32,33,36,37) |
| InChIKey | MIDBRYYVWHUHMT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|